| Id |
Subject |
Object |
Predicate |
Lexical cue |
| T42 |
0-75 |
Sentence |
denotes |
N-acetylneuraminic acid (Neu5Ac) was generated with the Hyperchem database. |
| T43 |
76-159 |
Sentence |
denotes |
9-O-acetyl-N-acetylneuraminic acid (9-O-SIA) was retrieved from pdb file 6Q06 [18]. |
| T44 |
160-225 |
Sentence |
denotes |
CLQ is N-(7-chloroquinolin-4-yl)-N,N-diéthyl-pentane-1,4-diamine. |
| T45 |
226-298 |
Sentence |
denotes |
Its three-dimensioanl structure was retrieved from pdb file # 4V2O [19]. |
| T46 |
299-378 |
Sentence |
denotes |
CLQ-OH is (RS)-2-[{4-[(7-chloroquinolin-4-yl)amino]pentyl}(ethyl)amino]ethanol. |
| T47 |
379-439 |
Sentence |
denotes |
CLQ-OH was generated by hydroxylation of CLQ with Hyperchem. |
| T48 |
440-533 |
Sentence |
denotes |
Both CLQ and CLQ-OH were energy-minimized and merged with water molecules as described below. |
